EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H22N4O6S4 |
| Net Charge | 0 |
| Average Mass | 518.664 |
| Monoisotopic Mass | 518.04222 |
| SMILES | [H][C@@](CSC(=S)Nc1ccc(NC(=S)SC[C@]([H])(/N=C(\C)O)C(=O)O)cc1)(/N=C(\C)O)C(=O)O |
| InChI | InChI=1S/C18H22N4O6S4/c1-9(23)19-13(15(25)26)7-31-17(29)21-11-3-5-12(6-4-11)22-18(30)32-8-14(16(27)28)20-10(2)24/h3-6,13-14H,7-8H2,1-2H3,(H,19,23)(H,20,24)(H,21,29)(H,22,30)(H,25,26)(H,27,28)/t13-,14-/m0/s1 |
| InChIKey | HTRJZMPLPYYXIN-KBPBESRZSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 1.8.1.* (oxidoreductase acting on sulfur group of donors, NAD(+) or NADP(+) as acceptor) inhibitor An EC 1.8.* (oxidoreductase acting on sulfur group of donors) inhibitor that interferes with the action of any such enzyme using NAD+ or NADP+ as acceptor (EC 1.8.1.*). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-AAPA (CHEBI:234428) has role EC 1.8.1.* (oxidoreductase acting on sulfur group of donors, NAD+ or NADP+ as acceptor) inhibitor (CHEBI:76869) |
| 2-AAPA (CHEBI:234428) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| (2R)-2-acetamido-3-[[4-[[(2R)-2-acetamido-2-carboxyethyl]sulfanylcarbothioylamino]phenyl]carbamothioylsulfanyl]propanoic acid |
| Synonym | Source |
|---|---|
| 2-acetylamino-3-[4-(2-acetylamino-2-carboxy-ethylsulfanylthiocarbonylamino)phenylthiocarbamoylsulfanyl]propionic acid | SUBMITTER |
| Citations |
|---|