EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C41H41N3O4S |
| Net Charge | 0 |
| Average Mass | 671.863 |
| Monoisotopic Mass | 671.28178 |
| SMILES | [H][C@@]12C=C[C@H](NC(C)=O)[C@@H]3Oc4c(O)cc(NC(=O)CCSC(c5ccccc5)(c5ccccc5)c5ccccc5)c5c4[C@@]31CCN(C)[C@@H]2C5 |
| InChI | InChI=1S/C41H41N3O4S/c1-26(45)42-32-19-18-31-34-24-30-33(25-35(46)38-37(30)40(31,39(32)48-38)21-22-44(34)2)43-36(47)20-23-49-41(27-12-6-3-7-13-27,28-14-8-4-9-15-28)29-16-10-5-11-17-29/h3-19,25,31-32,34,39,46H,20-24H2,1-2H3,(H,42,45)(H,43,47)/t31-,32-,34+,39-,40-/m0/s1 |
| InChIKey | MVFFDQPOEGZNPK-DESUNDFASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-AmidoMorHap (CHEBI:234422) has functional parent morphine (CHEBI:17303) |
| 1-AmidoMorHap (CHEBI:234422) has role hapten (CHEBI:59174) |
| 1-AmidoMorHap (CHEBI:234422) is a acetamides (CHEBI:22160) |
| 1-AmidoMorHap (CHEBI:234422) is a benzenes (CHEBI:22712) |
| 1-AmidoMorHap (CHEBI:234422) is a morphinane alkaloid (CHEBI:25418) |
| 1-AmidoMorHap (CHEBI:234422) is a organic heteropentacyclic compound (CHEBI:38164) |
| 1-AmidoMorHap (CHEBI:234422) is a organic sulfide (CHEBI:16385) |
| 1-AmidoMorHap (CHEBI:234422) is a secondary carboxamide (CHEBI:140325) |
| 1-AmidoMorHap (CHEBI:234422) is a tertiary amino compound (CHEBI:50996) |
| Incoming Relation(s) |
| 1-AmidoDihydroMorHap (CHEBI:234424) has functional parent 1-AmidoMorHap (CHEBI:234422) |
| IUPAC Name |
|---|
| N-(6α-acetamido-3-hydroxy-17-methyl-5α-7,8-didehydro-4,5-epoxymorphinan-1-yl)-3-[(triphenylmethyl)sulfanyl]propanamide |
| Synonyms | Source |
|---|---|
| N-((4R,4aR,7S,7aR,12bS)-7-acetamido-9-hydroxy-3-methyl-2,3,4,4a,7,7a-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl)-3-(tritylthio)propanamide | ChEBI |
| N-((7S,7aR)-7-acetamido-9-hydroxy-3-methyl-2,3,4,4a,7,7a-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl)-3-(tritylthio)propanamide | ChEBI |
| Citations |
|---|