EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H24NO11P |
| Net Charge | 0 |
| Average Mass | 377.283 |
| Monoisotopic Mass | 377.10870 |
| SMILES | NCCOP(=O)(O)O[C@@H]1[C@H](O)[C@@H](O)[C@H](OCC(O)CO)O[C@@H]1CO |
| InChI | InChI=1S/C11H24NO11P/c12-1-2-21-24(18,19)23-10-7(4-14)22-11(9(17)8(10)16)20-5-6(15)3-13/h6-11,13-17H,1-5,12H2,(H,18,19)/t6?,7-,8-,9-,10+,11-/m1/s1 |
| InChIKey | WOVPQLHRYGIECT-IJZVYLAISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Drosophila melanogaster (ncbitaxon:7227) | - | PubMed (39353950) | Found in seminal fluid of males. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| venerose (CHEBI:234415) has functional parent O-phosphoethanolamine (CHEBI:17553) |
| venerose (CHEBI:234415) has functional parent 1-O-glyceryl β-D-galactopyranoside (CHEBI:150213) |
| venerose (CHEBI:234415) has role animal metabolite (CHEBI:75767) |
| venerose (CHEBI:234415) is a galactosylglycerol derivative (CHEBI:63425) |
| venerose (CHEBI:234415) is a phospho sugar (CHEBI:33447) |
| venerose (CHEBI:234415) is a primary amino compound (CHEBI:50994) |
| IUPAC Name |
|---|
| 2,3-dihydroxypropyl 4-O-[(2-aminoethoxy)(hydroxy)phosphoryl]-β-D-galactopyranoside |
| Synonyms | Source |
|---|---|
| 1-O-[4-O-(2-aminoethylphosphate)-β-D-galactopyranosyl]-x-glycerol | SUBMITTER |
| 1-O-[4-O-(2-aminoethyl-phosphate)-β-D-galactopyranosyl]-x-glycerol | ChEBI |
| Citations |
|---|