EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18N4O |
| Net Charge | 0 |
| Average Mass | 282.347 |
| Monoisotopic Mass | 282.14806 |
| SMILES | Nc1ccc(-c2ccncc2)cc1NC(=O)N1CCCC1 |
| InChI | InChI=1S/C16H18N4O/c17-14-4-3-13(12-5-7-18-8-6-12)11-15(14)19-16(21)20-9-1-2-10-20/h3-8,11H,1-2,9-10,17H2,(H,19,21) |
| InChIKey | YZXBMJVMSBSGMM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). |
| Application: | nootropic agent Any compound that improves mental functions such as cognition, memory, intelligence, motivation, attention, and concentration. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| BRD6688 (CHEBI:234393) has role EC 3.5.1.98 (histone deacetylase) inhibitor (CHEBI:61115) |
| BRD6688 (CHEBI:234393) has role nootropic agent (CHEBI:66980) |
| BRD6688 (CHEBI:234393) is a biaryl (CHEBI:64459) |
| BRD6688 (CHEBI:234393) is a pyridines (CHEBI:26421) |
| BRD6688 (CHEBI:234393) is a pyrrolidinecarboxamide (CHEBI:46770) |
| BRD6688 (CHEBI:234393) is a substituted aniline (CHEBI:48975) |
| BRD6688 (CHEBI:234393) is a ureas (CHEBI:47857) |
| IUPAC Name |
|---|
| N-[2-amino-5-(pyridin-4-yl)phenyl]pyrrolidine-1-carboxamide |
| Synonyms | Source |
|---|---|
| BRD 6688 | SUBMITTER |
| BRD-6688 | SUBMITTER |
| N-[2-amino-5-(4-pyridinyl)phenyl]-1-pyrrolidinecarboxamide | ChEBI |
| N-[2-amino-5-(4-pyridyl)phenyl]-1-pyrrolidinecarboxamide | ChEBI |
| N-(2-amino-5-(pyridin-4-yl)phenyl)pyrrolidine-1-carboxamide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:1404562-17-9 | SUBMITTER |
| Citations |
|---|