EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H19FN2O2 |
| Net Charge | 0 |
| Average Mass | 314.360 |
| Monoisotopic Mass | 314.14306 |
| SMILES | Nc1ccc(-c2ccc(F)cc2)cc1NC(=O)C1CCOCC1 |
| InChI | InChI=1S/C18H19FN2O2/c19-15-4-1-12(2-5-15)14-3-6-16(20)17(11-14)21-18(22)13-7-9-23-10-8-13/h1-6,11,13H,7-10,20H2,(H,21,22) |
| InChIKey | ZFCDNONWGMYBHA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). |
| Application: | nootropic agent Any compound that improves mental functions such as cognition, memory, intelligence, motivation, attention, and concentration. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| BRD4884 (CHEBI:234392) has role EC 3.5.1.98 (histone deacetylase) inhibitor (CHEBI:61115) |
| BRD4884 (CHEBI:234392) has role nootropic agent (CHEBI:66980) |
| BRD4884 (CHEBI:234392) is a biaryl (CHEBI:64459) |
| BRD4884 (CHEBI:234392) is a monofluorobenzenes (CHEBI:83575) |
| BRD4884 (CHEBI:234392) is a oxanes (CHEBI:46942) |
| BRD4884 (CHEBI:234392) is a secondary carboxamide (CHEBI:140325) |
| BRD4884 (CHEBI:234392) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| N-(4-amino-4'-fluoro[biphenyl]-3-yl)tetrahydro-2H-pyran-4-carboxamide |
| Synonyms | Source |
|---|---|
| BRD 4884 | SUBMITTER |
| BRD-4884 | SUBMITTER |
| N-(4-amino-4'-fluoro[1,1'-biphenyl]-3-yl)oxane-4-carboxamide | IUPAC |
| N-(4-amino-4'-fluoro[1,1'-biphenyl]-3-yl)tetrahydro-2H-pyran-4-carboxamide | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| IWX | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:1404559-91-6 | SUBMITTER |
| Citations |
|---|