EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H30N2O2S |
| Net Charge | 0 |
| Average Mass | 338.517 |
| Monoisotopic Mass | 338.20280 |
| SMILES | [H][C@@](C)(CCN1CCC(C)CC1)N(C)S(=O)(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C18H30N2O2S/c1-15-8-11-20(12-9-15)13-10-17(3)19(4)23(21,22)18-7-5-6-16(2)14-18/h5-7,14-15,17H,8-13H2,1-4H3/t17-/m1/s1 |
| InChIKey | AGVNHDNTFYHZNL-QGZVFWFLSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| Application: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SB 258719 (CHEBI:234391) has role serotonergic antagonist (CHEBI:48279) |
| SB 258719 (CHEBI:234391) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| N,3-dimethyl-N-[(2R)-4-(4-methylpiperidin-1-yl)butan-2-yl]benzenesulfonamide |
| Manual Xrefs | Databases |
|---|---|
| SB-258719 | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:195199-95-2 | SUBMITTER |
| Citations |
|---|