EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:234390 - SB216641
| Formula | C28H30N4O4.HCl |
| Net Charge | 0 |
| Average Mass | 523.033 |
| Monoisotopic Mass | 522.20338 |
| SMILES | COc1ccc(NC(=O)c2ccc(-c3ccc(-c4noc(C)n4)cc3C)cc2)cc1OCCN(C)C.Cl |
| InChI | InChI=1S/C28H30N4O4.ClH/c1-18-16-22(27-29-19(2)36-31-27)10-12-24(18)20-6-8-21(9-7-20)28(33)30-23-11-13-25(34-5)26(17-23)35-15-14-32(3)4;/h6-13,16-17H,14-15H2,1-5H3,(H,30,33);1H |
| InChIKey | JPBMDMNORXKGHZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| Application: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SB216641 (CHEBI:234390) has role serotonergic antagonist (CHEBI:48279) |
| SB216641 (CHEBI:234390) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| N-[3-[2-(dimethylamino)ethoxy]-4-methoxyphenyl]-4-[2-methyl-4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]benzamide;hydrochloride |
| Synonyms | Source |
|---|---|
| SB 216641 | SUBMITTER |
| SB216641A | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| CAS:193611-67-5 | SUBMITTER |
| Citations |
|---|