EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H27N5O5S |
| Net Charge | 0 |
| Average Mass | 461.544 |
| Monoisotopic Mass | 461.17329 |
| SMILES | [H][C@@]1(O)CON(C(=O)c2c(Cc3c(C)nnc3C)sc3c2c(=O)n(C)c(=O)n3CC(C)C)C1 |
| InChI | InChI=1S/C21H27N5O5S/c1-10(2)7-25-20-17(18(28)24(5)21(25)30)16(19(29)26-8-13(27)9-31-26)15(32-20)6-14-11(3)22-23-12(14)4/h10,13,27H,6-9H2,1-5H3,(H,22,23)/t13-/m0/s1 |
| InChIKey | ISIVOJWVBJIOFM-ZDUSSCGKSA-N |
| Roles Classification |
|---|
| Biological Role: | inhibitor A substance that diminishes the rate of a chemical reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| AR-C155858 (CHEBI:234387) has role inhibitor (CHEBI:35222) |
| AR-C155858 (CHEBI:234387) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 6-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-5-[(4S)-4-hydroxy-1,2-oxazolidine-2-carbonyl]-3-methyl-1-(2-methylpropyl)thieno[2,3-d]pyrimidine-2,4-dione |
| Registry Numbers | Sources |
|---|---|
| CAS:496791-37-8 | SUBMITTER |
| Citations |
|---|