EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9NO4 |
| Net Charge | -2 |
| Average Mass | 195.174 |
| Monoisotopic Mass | 195.05425 |
| SMILES | Cc1c(O)nc(CC(=O)[O-])c(C)c1[O-] |
| InChI | InChI=1S/C9H11NO4/c1-4-6(3-7(11)12)10-9(14)5(2)8(4)13/h3H2,1-2H3,(H,11,12)(H2,10,13,14)/p-2 |
| InChIKey | AVBVBQSPVBVXPJ-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-carboxymethyl-3,5-dimethyl-4-hydroxypyridin-2-ol(2−) (CHEBI:234381) is a monocarboxylic acid anion (CHEBI:35757) |
| 6-carboxymethyl-3,5-dimethyl-4-hydroxypyridin-2-ol(2−) (CHEBI:234381) is a pyridin-2-ol (CHEBI:16540) |
| UniProt Name | Source |
|---|---|
| 6-carboxymethyl-3,5-dimethyl-4-hydroxypyridin-2-ol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-27515 | MetaCyc |
| Citations |
|---|