EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:234378 - HTH-01-015
| Formula | C26H28N8O |
| Net Charge | 0 |
| Average Mass | 468.565 |
| Monoisotopic Mass | 468.23861 |
| SMILES | Cc1nc(Nc2cnn(C3CCNCC3)c2)nc2c1N(C)C(=O)c1cc3ccccc3cc1N2C |
| InChI | InChI=1S/C26H28N8O/c1-16-23-24(31-26(29-16)30-19-14-28-34(15-19)20-8-10-27-11-9-20)32(2)22-13-18-7-5-4-6-17(18)12-21(22)25(35)33(23)3/h4-7,12-15,20,27H,8-11H2,1-3H3,(H,29,30,31) |
| InChIKey | CHSDJDLAKKAWCI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of non-specific serine/threonine protein kinase (EC 2.7.11.1), a kinase enzyme involved in phosphorylation of hydroxy group of serine or threonine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| HTH-01-015 (CHEBI:234378) has role EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor (CHEBI:50925) |
| HTH-01-015 (CHEBI:234378) is a aromatic amine (CHEBI:33860) |
| HTH-01-015 (CHEBI:234378) is a organic heterotetracyclic compound (CHEBI:38163) |
| HTH-01-015 (CHEBI:234378) is a piperidines (CHEBI:26151) |
| HTH-01-015 (CHEBI:234378) is a pyrazoles (CHEBI:26410) |
| HTH-01-015 (CHEBI:234378) is a secondary amino compound (CHEBI:50995) |
| HTH-01-015 (CHEBI:234378) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 4,5,13-trimethyl-2-{[1-(piperidin-4-yl)-1H-pyrazol-4-yl]amino}-5,13-dihydro-6H-naphtho[2,3-e]pyrimido[5,4-b][1,4]diazepin-6-one |
| Synonyms | Source |
|---|---|
| HTH 01 015 | SUBMITTER |
| HTH01015 | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| CAS:1613724-42-7 | SUBMITTER |
| Citations |
|---|