EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H29N3O |
| Net Charge | 0 |
| Average Mass | 351.494 |
| Monoisotopic Mass | 351.23106 |
| SMILES | CCOc1ccc(Cc2nc3ccccc3n2CCN(CC)CC)cc1 |
| InChI | InChI=1S/C22H29N3O/c1-4-24(5-2)15-16-25-21-10-8-7-9-20(21)23-22(25)17-18-11-13-19(14-12-18)26-6-3/h7-14H,4-6,15-17H2,1-3H3 |
| InChIKey | BMLPNUNXHUGDOI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| Applications: | mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| etodesnitazene (CHEBI:234368) has role opioid analgesic (CHEBI:35482) |
| etodesnitazene (CHEBI:234368) has role μ-opioid receptor agonist (CHEBI:55322) |
| etodesnitazene (CHEBI:234368) is a aromatic ether (CHEBI:35618) |
| etodesnitazene (CHEBI:234368) is a benzimidazoles (CHEBI:22715) |
| etodesnitazene (CHEBI:234368) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 2-[2-(4-ethoxybenzyl)-1H-benzimidazol-1-yl]-N,N-diethylethanamine |
| Synonyms | Source |
|---|---|
| 1-(2-(diethylamino)ethyl)-2-(p-exthoxybenzyl)benzimidazole | ChEBI |
| 2-(2-(4-ethoxybenzyl)-1H-benzimidazol-1-yl)-N,N-diethylethan-1-amine | ChEBI |
| 2-{2-[(4-ethoxyphenyl)methyl]-1H-benzimidazol-1-yl}-N,N-diethylethan-1-amine | IUPAC |
| 2-[(4-ethoxyphenyl)methyl]-N,N-diethyl-1H-benzimidazole-1-ethanamine | ChEBI |
| desnitroetonitazene | ChEBI |
| etazen | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C22827 | KEGG COMPOUND |
| Etodesnitazene | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:14030-76-3 | KEGG COMPOUND |
| Citations |
|---|