EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H23FN4O2 |
| Net Charge | 0 |
| Average Mass | 370.428 |
| Monoisotopic Mass | 370.18050 |
| SMILES | CCN(CC)CCn1c(Cc2ccc(F)cc2)nc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C20H23FN4O2/c1-3-23(4-2)11-12-24-19-10-9-17(25(26)27)14-18(19)22-20(24)13-15-5-7-16(21)8-6-15/h5-10,14H,3-4,11-13H2,1-2H3 |
| InChIKey | ZTWHIDCAGRMKTC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| Applications: | mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flunitazene (CHEBI:234366) has role opioid analgesic (CHEBI:35482) |
| flunitazene (CHEBI:234366) has role μ-opioid receptor agonist (CHEBI:55322) |
| flunitazene (CHEBI:234366) is a C-nitro compound (CHEBI:35716) |
| flunitazene (CHEBI:234366) is a benzimidazoles (CHEBI:22715) |
| flunitazene (CHEBI:234366) is a monofluorobenzenes (CHEBI:83575) |
| flunitazene (CHEBI:234366) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N,N-diethyl-2-[2-(4-fluorobenzyl)-5-nitro-1H-benzimidazol-1-yl]ethanamine |
| Synonyms | Source |
|---|---|
| 4-fluoro desethoxyetonitazene | ChEBI |
| N,N-diethyl-2-(2-(4-fluorobenzyl)-5-nitro-1H-benzimidazol-1-yl)ethan-1-amine | ChEBI |
| N,N-diethyl-2-{2-[(4-fluorophenyl)methyl]-5-nitro-1H-benzimidazol-1-yl}ethan-1-amine | IUPAC |
| N,N-diethyl-2-[2-[(4-fluorophenyl)methyl]-5-nitro-benzimidazol-1-yl]ethanamine | ChEBI |
| fluonitazene | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Flunitazene | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:2249-36-7 | PubChem Compound |
| Citations |
|---|