EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H32N4O3 |
| Net Charge | 0 |
| Average Mass | 424.545 |
| Monoisotopic Mass | 424.24744 |
| SMILES | CCCCOc1ccc(Cc2nc3cc([N+](=O)[O-])ccc3n2CCN(CC)CC)cc1 |
| InChI | InChI=1S/C24H32N4O3/c1-4-7-16-31-21-11-8-19(9-12-21)17-24-25-22-18-20(28(29)30)10-13-23(22)27(24)15-14-26(5-2)6-3/h8-13,18H,4-7,14-17H2,1-3H3 |
| InChIKey | UZZPOLCDCVWLAZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. |
| Applications: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| butonitazene (CHEBI:234364) has role opioid analgesic (CHEBI:35482) |
| butonitazene (CHEBI:234364) has role μ-opioid receptor agonist (CHEBI:55322) |
| butonitazene (CHEBI:234364) is a C-nitro compound (CHEBI:35716) |
| butonitazene (CHEBI:234364) is a aromatic ether (CHEBI:35618) |
| butonitazene (CHEBI:234364) is a benzimidazoles (CHEBI:22715) |
| butonitazene (CHEBI:234364) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 2-[2-(4-butoxybenzyl)-5-nitro-1H-benzimidazol-1-yl]-N,N-diethylethanamine |
| Synonyms | Source |
|---|---|
| 2-{2-[(4-butoxyphenyl)methyl]-5-nitro-1H-benzimidazol-1-yl}-N,N-diethylethan-1-amine | IUPAC |
| 2-(2-(4-butoxybenzyl)-5-nitro-1H-benzimidazol-1-yl)-N,N-diethylethan-1-amine | ChEBI |
| 2-[(4-butoxyphenyl)methyl]-N,N-diethyl-5-nitro-1H-benzimidazole-1-ethanamine | ChEBI |
| 2-(p-butoxybenzyl)-1-[2-(diethylamino)ethyl]-5-nitrobenzimidazole | ChEBI |
| butoxynitazene | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Butonitazene | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:95810-54-1 | PubChem Compound |
| Citations |
|---|