EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H30N4O3 |
| Net Charge | 0 |
| Average Mass | 410.518 |
| Monoisotopic Mass | 410.23179 |
| SMILES | CCCOc1ccc(Cc2nc3cc([N+](=O)[O-])ccc3n2CCN(CC)CC)cc1 |
| InChI | InChI=1S/C23H30N4O3/c1-4-15-30-20-10-7-18(8-11-20)16-23-24-21-17-19(27(28)29)9-12-22(21)26(23)14-13-25(5-2)6-3/h7-12,17H,4-6,13-16H2,1-3H3 |
| InChIKey | SJHUJFHOXYDSJY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| Applications: | mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| protonitazene (CHEBI:234363) has role opioid analgesic (CHEBI:35482) |
| protonitazene (CHEBI:234363) has role μ-opioid receptor agonist (CHEBI:55322) |
| protonitazene (CHEBI:234363) is a C-nitro compound (CHEBI:35716) |
| protonitazene (CHEBI:234363) is a aromatic ether (CHEBI:35618) |
| protonitazene (CHEBI:234363) is a benzimidazoles (CHEBI:22715) |
| protonitazene (CHEBI:234363) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N,N-diethyl-2-[5-nitro-2-(4-propoxybenzyl)-1H-benzimidazol-1-yl]ethanamine |
| Synonyms | Source |
|---|---|
| N,N-diethyl-2-{5-nitro-2-[(4-propoxyphenyl)methyl]-1H-benzimidazol-1-yl}ethan-1-amine | IUPAC |
| N,N-diethyl-5-nitro-2-[(4-propoxyphenyl)methyl]-1H-benzimidazole-1-ethanamine | ChEBI |
| N,N-diethyl-2-{2-[(4-propoxyphenyl)methyl]-5-nitro-1H-benzimidazol-1-yl}ethan-1-amine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C22683 | KEGG COMPOUND |
| Protonitazene | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:95958-84-2 | KEGG COMPOUND |
| Citations |
|---|