EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26N4O3 |
| Net Charge | 0 |
| Average Mass | 382.464 |
| Monoisotopic Mass | 382.20049 |
| SMILES | CCN(CC)CCn1c(Cc2ccc(OC)cc2)nc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C21H26N4O3/c1-4-23(5-2)12-13-24-20-11-8-17(25(26)27)15-19(20)22-21(24)14-16-6-9-18(28-3)10-7-16/h6-11,15H,4-5,12-14H2,1-3H3 |
| InChIKey | HNGZTLMRQTVPBH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| Applications: | mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| metonitazene (CHEBI:234362) has role opioid analgesic (CHEBI:35482) |
| metonitazene (CHEBI:234362) has role μ-opioid receptor agonist (CHEBI:55322) |
| metonitazene (CHEBI:234362) is a C-nitro compound (CHEBI:35716) |
| metonitazene (CHEBI:234362) is a benzimidazoles (CHEBI:22715) |
| metonitazene (CHEBI:234362) is a monomethoxybenzene (CHEBI:25235) |
| metonitazene (CHEBI:234362) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N,N-diethyl-2-[2-(4-methoxybenzyl)-5-nitro-1H-benzimidazol-1-yl]ethanamine |
| Synonyms | Source |
|---|---|
| 1-(diethylamino)ethyl-2-(4-methoxybenzyl)-5-nitrobenzimidazole | KEGG COMPOUND |
| N,N-diethyl-2-{2-[(4-methoxyphenyl)methyl]-5-nitro-1H-benzimidazol-1-yl}ethan-1-amine | IUPAC |
| N,N-diethyl-2-[(4-methoxyphenyl)methyl]-5-nitro-1H-benzimidazole-1-ethanamine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C22727 | KEGG COMPOUND |
| Metonitazene | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:14680-51-4 | KEGG COMPOUND |
| Citations |
|---|