EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28N4O3 |
| Net Charge | 0 |
| Average Mass | 396.491 |
| Monoisotopic Mass | 396.21614 |
| SMILES | CCOc1ccc(Cc2nc3cc([N+](=O)[O-])ccc3n2CCN(CC)CC)cc1 |
| InChI | InChI=1S/C22H28N4O3/c1-4-24(5-2)13-14-25-21-12-9-18(26(27)28)16-20(21)23-22(25)15-17-7-10-19(11-8-17)29-6-3/h7-12,16H,4-6,13-15H2,1-3H3 |
| InChIKey | PXDBZSCGSQSKST-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| Applications: | mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| etonitazene (CHEBI:234361) has role opioid analgesic (CHEBI:35482) |
| etonitazene (CHEBI:234361) has role μ-opioid receptor agonist (CHEBI:55322) |
| etonitazene (CHEBI:234361) is a C-nitro compound (CHEBI:35716) |
| etonitazene (CHEBI:234361) is a aromatic ether (CHEBI:35618) |
| etonitazene (CHEBI:234361) is a benzimidazoles (CHEBI:22715) |
| etonitazene (CHEBI:234361) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 2-[2-(4-ethoxybenzyl)-5-nitro-1H-benzimidazol-1-yl]-N,N-diethylethanamine |
| INNs | Source |
|---|---|
| etonitazenum | WHO MedNet |
| étonitazéne | WHO MedNet |
| etonitazeno | WHO MedNet |
| etonitazene | WHO MedNet |
| Synonyms | Source |
|---|---|
| N-[2-[2-(4-ethoxybenzyl)-5-nitrobenzimidazol-1-yl]ethyl]diethylamine | ChEBI |
| 1-(2-diethylaminoethyl)-2-p-ethoxybenzyl-5-nitrobenzimidazole | ChEBI |
| 1-(β-diethylaminoethyl)-2-(p-ethoxybenzyl)-5-nitrobenzimidazole | ChEBI |
| 2-[(4-ethoxyphenyl)methyl]-N,N-diethyl-5-nitro-1H-benzimidazole-1-ethanamine | ChEBI |
| Ciba 20-684BA | ChEBI |
| NIH 7607 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| DB01462 | DrugBank |
| D12669 | KEGG DRUG |
| Etonitazene | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:911-65-9 | KEGG DRUG |
| Citations |
|---|