EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H30N4O3 |
| Net Charge | 0 |
| Average Mass | 410.518 |
| Monoisotopic Mass | 410.23179 |
| SMILES | CCN(CC)CCn1c(Cc2ccc(OC(C)C)cc2)nc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C23H30N4O3/c1-5-25(6-2)13-14-26-22-12-9-19(27(28)29)16-21(22)24-23(26)15-18-7-10-20(11-8-18)30-17(3)4/h7-12,16-17H,5-6,13-15H2,1-4H3 |
| InChIKey | OIOQREYBGDAYGT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. |
| Applications: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isotonitazene (CHEBI:234360) has role opioid analgesic (CHEBI:35482) |
| isotonitazene (CHEBI:234360) has role μ-opioid receptor agonist (CHEBI:55322) |
| isotonitazene (CHEBI:234360) is a C-nitro compound (CHEBI:35716) |
| isotonitazene (CHEBI:234360) is a aromatic ether (CHEBI:35618) |
| isotonitazene (CHEBI:234360) is a benzimidazoles (CHEBI:22715) |
| isotonitazene (CHEBI:234360) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N,N-diethyl-2-{5-nitro-2-[4-(propan-2-yloxy)benzyl]-1H-benzimidazol-1-yl}ethanamine |
| Synonyms | Source |
|---|---|
| 1-[2-(diethylamino)ethyl]-2-(p-isopropoxybenzyl)-5-nitrobenzimidazole | ChEBI |
| 1-(diethylamino)ethyl-2-(4-isopropoxybenzyl)-5-nitrobenzimidazole | KEGG COMPOUND |
| N,N-diethyl-2-[[4-(1-methylethoxy)phenyl]methyl]-5-nitro-1H-benzimidazole-1-ethanamine | ChEBI |
| N,N-diethyl-2-[5-nitro-2-({4-[(propan-2-yl)oxy]phenyl}methyl)-1H-benzimidazol-1-yl]ethan-1-amine | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| C22725 | KEGG COMPOUND |
| Isotonitazene | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:14188-81-9 | KEGG COMPOUND |
| Citations |
|---|