EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H25F2N3O4 |
| Net Charge | 0 |
| Average Mass | 457.477 |
| Monoisotopic Mass | 457.18131 |
| SMILES | C[C@@H](Nc1cc(F)cc(F)c1)c1cc(C(=O)N(C)C)cc2c(=O)cc(N3CCOCC3)oc12 |
| InChI | InChI=1S/C24H25F2N3O4/c1-14(27-18-11-16(25)10-17(26)12-18)19-8-15(24(31)28(2)3)9-20-21(30)13-22(33-23(19)20)29-4-6-32-7-5-29/h8-14,27H,4-7H2,1-3H3/t14-/m1/s1 |
| InChIKey | LMJFJIDLEAWOQJ-CQSZACIVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor An inhibitor of phosphatidylinositol 3-kinase, EC 2.7.1.137, a family of related enzymes capable of phosphorylating the 3 position hydroxy group of the inositol ring of a phosphatidylinositol. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| AZD8186 (CHEBI:234358) has role antineoplastic agent (CHEBI:35610) |
| AZD8186 (CHEBI:234358) has role EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor (CHEBI:50914) |
| AZD8186 (CHEBI:234358) is a chromones (CHEBI:23238) |
| AZD8186 (CHEBI:234358) is a difluorobenzene (CHEBI:38582) |
| AZD8186 (CHEBI:234358) is a morpholines (CHEBI:38785) |
| AZD8186 (CHEBI:234358) is a secondary amino compound (CHEBI:50995) |
| AZD8186 (CHEBI:234358) is a substituted aniline (CHEBI:48975) |
| AZD8186 (CHEBI:234358) is a tertiary carboxamide (CHEBI:140326) |
| IUPAC Name |
|---|
| 8-[(1R)-1-(3,5-difluoroanilino)ethyl]-N,N-dimethyl-2-(morpholin-4-yl)-4-oxo-4H-chromene-6-carboxamide |
| Synonyms | Source |
|---|---|
| AZD 8186 | SUBMITTER |
| AZD-8186 | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| DB15029 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:1627494-13-6 | SUBMITTER |
| Citations |
|---|