EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H31N9O3 |
| Net Charge | 0 |
| Average Mass | 469.550 |
| Monoisotopic Mass | 469.25499 |
| SMILES | CCn1nc(C2CCN(C(=O)CCO)CC2)nc1-c1cnc(N)c(-c2nnc(C(C)(C)C)o2)n1 |
| InChI | InChI=1S/C22H31N9O3/c1-5-31-19(26-18(29-31)13-6-9-30(10-7-13)15(33)8-11-32)14-12-24-17(23)16(25-14)20-27-28-21(34-20)22(2,3)4/h12-13,32H,5-11H2,1-4H3,(H2,23,24) |
| InChIKey | ZGRDYKFVDCFJCZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor An inhibitor of phosphatidylinositol 3-kinase, EC 2.7.1.137, a family of related enzymes capable of phosphorylating the 3 position hydroxy group of the inositol ring of a phosphatidylinositol. |
| Applications: | bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| AZD-8835 (CHEBI:234357) has role antineoplastic agent (CHEBI:35610) |
| AZD-8835 (CHEBI:234357) has role apoptosis inducer (CHEBI:68495) |
| AZD-8835 (CHEBI:234357) has role bone density conservation agent (CHEBI:50646) |
| AZD-8835 (CHEBI:234357) has role EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor (CHEBI:50914) |
| AZD-8835 (CHEBI:234357) is a N-acylpiperidine (CHEBI:48591) |
| AZD-8835 (CHEBI:234357) is a 1,3,4-oxadiazoles (CHEBI:46810) |
| AZD-8835 (CHEBI:234357) is a primary alcohol (CHEBI:15734) |
| AZD-8835 (CHEBI:234357) is a pyrazines (CHEBI:38314) |
| AZD-8835 (CHEBI:234357) is a triazoles (CHEBI:35727) |
| IUPAC Name |
|---|
| 1-(4-{5-[5-amino-6-(5-tert-butyl-1,3,4-oxadiazol-2-yl)pyrazin-2-yl]-1-ethyl-1H-1,2,4-triazol-3-yl}piperidin-1-yl)-3-hydroxypropan-1-one |
| Synonyms | Source |
|---|---|
| 1-(4-(5-(5-amino-6-(5-tert-butyl-1,3,4-oxadiazol-2-yl)pyrazin-2-yl)-1-ethyl-1,2,4-triazol-3-yl)piperidin-1-yl)-3-hydroxypropan-1-one | ChEBI |
| AZD 8835 | SUBMITTER |
| AZD8835 | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| CAS:1620576-64-8 | SUBMITTER |
| Citations |
|---|