EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H38ClN5O4 |
| Net Charge | 0 |
| Average Mass | 592.140 |
| Monoisotopic Mass | 591.26123 |
| SMILES | CC(C)Oc1ccc(C(=O)N[C@H](CNC(=O)CN(C)C)Cc2ccc(-c3cn4cccc([C@H](C)O)c4n3)cc2)cc1Cl |
| InChI | InChI=1S/C32H38ClN5O4/c1-20(2)42-29-13-12-24(16-27(29)33)32(41)35-25(17-34-30(40)19-37(4)5)15-22-8-10-23(11-9-22)28-18-38-14-6-7-26(21(3)39)31(38)36-28/h6-14,16,18,20-21,25,39H,15,17,19H2,1-5H3,(H,34,40)(H,35,41)/t21-,25-/m0/s1 |
| InChIKey | WHMXDBPHBVLYRC-OFVILXPXSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antimitotic Any compound that inhibits cell division (mitosis). centromere protein E inhibitor Any inhibitor of centromere protein E. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GSK-923295 (CHEBI:234356) has role antimitotic (CHEBI:64911) |
| GSK-923295 (CHEBI:234356) has role antineoplastic agent (CHEBI:35610) |
| GSK-923295 (CHEBI:234356) has role centromere protein E inhibitor (CHEBI:234476) |
| GSK-923295 (CHEBI:234356) is a aromatic ether (CHEBI:35618) |
| GSK-923295 (CHEBI:234356) is a benzamides (CHEBI:22702) |
| GSK-923295 (CHEBI:234356) is a imidazopyridine (CHEBI:46908) |
| GSK-923295 (CHEBI:234356) is a monochlorobenzenes (CHEBI:83403) |
| GSK-923295 (CHEBI:234356) is a secondary alcohol (CHEBI:35681) |
| GSK-923295 (CHEBI:234356) is a secondary carboxamide (CHEBI:140325) |
| GSK-923295 (CHEBI:234356) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 3-chloro-N-[(2S)-1-[(N,N-dimethylglycyl)amino]-3-(4-{8-[(1S)-1-hydroxyethyl]imidazo[1,2-a]pyridin-2-yl}phenyl)propan-2-yl]-4-(propan-2-yloxy)benzamide |
| Synonyms | Source |
|---|---|
| GSK 923295 | ChEBI |
| GSK923295 | ChEBI |
| GSK923295A | ChEBI |
| GSK 923295A | ChEBI |
| GSK-923295A | ChEBI |
| GSK295 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| DB06097 | DrugBank |
| LSM-45692 | LINCS |
| WO2010102157 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:1088965-37-0 | SUBMITTER |
| Citations |
|---|