EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18N2.C4H4O4 |
| Net Charge | 0 |
| Average Mass | 354.406 |
| Monoisotopic Mass | 354.15796 |
| SMILES | CN1Cc2c(N)cccc2C(c2ccccc2)C1.[H]/C(C(=O)O)=C(\[H])C(=O)O |
| InChI | InChI=1S/C16H18N2.C4H4O4/c1-18-10-14(12-6-3-2-4-7-12)13-8-5-9-16(17)15(13)11-18;5-3(6)1-2-4(7)8/h2-9,14H,10-11,17H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | GEOCVSMCLVIOEV-BTJKTKAUSA-N |
| Roles Classification |
|---|
| Biological Role: | dopamine uptake inhibitor A dopaminergic agent that blocks the transport of dopamine into axon terminals or into storage vesicles within terminals. Most of the adrenergic uptake inhibitors also inhibit dopamine uptake. |
| Application: | dopamine uptake inhibitor A dopaminergic agent that blocks the transport of dopamine into axon terminals or into storage vesicles within terminals. Most of the adrenergic uptake inhibitors also inhibit dopamine uptake. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nomifensine maleate (CHEBI:234352) has role dopamine uptake inhibitor (CHEBI:51039) |
| nomifensine maleate (CHEBI:234352) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| (Z)-but-2-enedioic acid;2-methyl-4-phenyl-3,4-dihydro-1H-isoquinolin-8-amine |
| Manual Xrefs | Databases |
|---|---|
| D05200 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:32795-47-4 | SUBMITTER |
| Citations |
|---|