EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H9Br2NO |
| Net Charge | 0 |
| Average Mass | 355.029 |
| Monoisotopic Mass | 352.90509 |
| SMILES | OCc1cc(Br)cc2c1nc1ccc(Br)cc12 |
| InChI | InChI=1S/C13H9Br2NO/c14-8-1-2-12-10(4-8)11-5-9(15)3-7(6-17)13(11)16-12/h1-5,16-17H,6H2 |
| InChIKey | MQDDORZTQSLIRD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | inhibitor A substance that diminishes the rate of a chemical reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| adhibin (CHEBI:234351) has role inhibitor (CHEBI:35222) |
| adhibin (CHEBI:234351) is a organic molecular entity (CHEBI:50860) |
| Synonym | Source |
|---|---|
| (3,6-dibromo-9H-carbazol-1-yl)methanol | SUBMITTER |
| Citations |
|---|