EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H33N3O2 |
| Net Charge | 0 |
| Average Mass | 455.602 |
| Monoisotopic Mass | 455.25728 |
| SMILES | [H]C(=O)N1CCC(C(=O)NCCN2CCC(=C3c4ccccc4C=Cc4ccccc43)CC2)CC1 |
| InChI | InChI=1S/C29H33N3O2/c33-21-32-18-13-25(14-19-32)29(34)30-15-20-31-16-11-24(12-17-31)28-26-7-3-1-5-22(26)9-10-23-6-2-4-8-27(23)28/h1-10,21,25H,11-20H2,(H,30,34) |
| InChIKey | BSPMYKLEFGUTSI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| Application: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| AT-1015 free base (CHEBI:234339) has role serotonergic antagonist (CHEBI:48279) |
| AT-1015 free base (CHEBI:234339) is a aldehyde (CHEBI:17478) |
| AT-1015 free base (CHEBI:234339) is a carbotricyclic compound (CHEBI:38032) |
| AT-1015 free base (CHEBI:234339) is a piperidinecarboxamide (CHEBI:48592) |
| AT-1015 free base (CHEBI:234339) is a secondary carboxamide (CHEBI:140325) |
| AT-1015 free base (CHEBI:234339) is conjugate base of AT-1015(1+) (CHEBI:234342) |
| Incoming Relation(s) |
| AT-1015(1+) (CHEBI:234342) is conjugate acid of AT-1015 free base (CHEBI:234339) |
| IUPAC Name |
|---|
| N-{2-[4-(5H-dibenzo[a,d][7]annulen-5-ylidene)piperidin-1-yl]ethyl}-1-formylpiperidine-4-carboxamide |
| Synonyms | Source |
|---|---|
| AT-1015 (free base) | ChEBI |
| AT-1015 free base anhydrous | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:173722-21-9 | ChEBI |