EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H24F3N5O5S |
| Net Charge | 0 |
| Average Mass | 515.514 |
| Monoisotopic Mass | 515.14502 |
| SMILES | Cc1nnc(C(F)(F)F)c1Cc1sc2c(c1C(=O)N1C[C@](C)(O)CO1)c(=O)n(C)c(=O)n2C(C)C |
| InChI | InChI=1S/C21H24F3N5O5S/c1-9(2)29-18-14(16(30)27(5)19(29)32)13(17(31)28-7-20(4,33)8-34-28)12(35-18)6-11-10(3)25-26-15(11)21(22,23)24/h9,33H,6-8H2,1-5H3,(H,25,26)/t20-/m0/s1 |
| InChIKey | PRNXOFBDXNTIFG-FQEVSTJZSA-N |
| Roles Classification |
|---|
| Biological Role: | monocarboxylate transporter 1 inhibitor Any compound that inhibits the action of monocarboxylate transporter 1. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| AZD3965 (CHEBI:234329) has role antineoplastic agent (CHEBI:35610) |
| AZD3965 (CHEBI:234329) has role monocarboxylate transporter 1 inhibitor (CHEBI:234483) |
| AZD3965 (CHEBI:234329) is a organofluorine compound (CHEBI:37143) |
| AZD3965 (CHEBI:234329) is a oxazolidines (CHEBI:38329) |
| AZD3965 (CHEBI:234329) is a pyrazoles (CHEBI:26410) |
| AZD3965 (CHEBI:234329) is a tertiary carboxamide (CHEBI:140326) |
| AZD3965 (CHEBI:234329) is a thienopyrimidine (CHEBI:143212) |
| IUPAC Name |
|---|
| 5-{[(4S)-4-hydroxy-4-methyl-1,2-oxazolidin-2-yl]carbonyl}-3-methyl-6-{[5-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]methyl}-1-(propan-2-yl)thieno[2,3-d]pyrimidine-2,4(1H,3H)-dione |
| Synonyms | Source |
|---|---|
| 5-[(4S)-4-hydroxy-4-methyl-1,2-oxazolidine-2-carbonyl]-3-methyl-6-{[5-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]methyl}-1-(propan-2-yl)thieno[2,3-d]pyrimidine-2,4(1H,3H)-dione | IUPAC |
| AZD 3965 | ChEBI |
| AZD-3965 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:1448671-31-5 | ChEBI |
| Citations |
|---|