EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H19N5OS |
| Net Charge | 0 |
| Average Mass | 293.396 |
| Monoisotopic Mass | 293.13103 |
| SMILES | CSC[C@H]1CN(Cc2cnc3c(N)ncnc23)C[C@@H]1O |
| InChI | InChI=1S/C13H19N5OS/c1-20-6-9-4-18(5-10(9)19)3-8-2-15-12-11(8)16-7-17-13(12)14/h2,7,9-10,15,19H,3-6H2,1H3,(H2,14,16,17)/t9-,10+/m1/s1 |
| InChIKey | NTHMDFGHOCNNOE-ZJUUUORDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 2.4.2.28 (S-methyl-5'-thioadenosine phosphorylase) inhibitor An EC 2.4.2.* (pentosyltransferase) inhibitor that interferes with the action of S-methyl-5'-thioadenosine phosphorylase (EC 2.4.2.28). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methylthioadenosine-DADMe immucillin-A (CHEBI:234322) has role antineoplastic agent (CHEBI:35610) |
| methylthioadenosine-DADMe immucillin-A (CHEBI:234322) has role apoptosis inducer (CHEBI:68495) |
| methylthioadenosine-DADMe immucillin-A (CHEBI:234322) has role EC 2.4.2.28 (S-methyl-5'-thioadenosine phosphorylase) inhibitor (CHEBI:235466) |
| methylthioadenosine-DADMe immucillin-A (CHEBI:234322) is a aromatic amine (CHEBI:33860) |
| methylthioadenosine-DADMe immucillin-A (CHEBI:234322) is a methyl sulfide (CHEBI:86315) |
| methylthioadenosine-DADMe immucillin-A (CHEBI:234322) is a monohydroxypyrrolidine (CHEBI:46777) |
| methylthioadenosine-DADMe immucillin-A (CHEBI:234322) is a pyrrolopyrimidine (CHEBI:38670) |
| methylthioadenosine-DADMe immucillin-A (CHEBI:234322) is a secondary alcohol (CHEBI:35681) |
| methylthioadenosine-DADMe immucillin-A (CHEBI:234322) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| (3R,4S)-1-[(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)methyl]-4-[(methylsulfanyl)methyl]pyrrolidin-3-ol |
| Synonyms | Source |
|---|---|
| (3R,4S)-1-(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-ylmethyl)-4-methylsulfanylmethyl-pyrrolidin-3-ol | SUBMITTER |
| (3R,4S)-1-[(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)methyl]-4-[(methylthio)methyl]-3-pyrrolidinol | ChEBI |
| methylthio-DADMe-immucillin A | SUBMITTER |
| methylthio-DADMe-immucillin-A | ChEBI |
| MT-DADMe-ImmA | ChEBI |
| MT-DADMe-Immucillin-A | ChEBI |
| Citations |
|---|