EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9NS2.H3N |
| Net Charge | 0 |
| Average Mass | 164.299 |
| Monoisotopic Mass | 164.04419 |
| SMILES | N.S=C(S)N1CCCC1 |
| InChI | InChI=1S/C5H9NS2.H3N/c7-5(8)6-3-1-2-4-6;/h1-4H2,(H,7,8);1H3 |
| InChIKey | MDDIUTVUBYEEEM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | NF-kappaB inhibitor An inhibitor of NF-κB (nuclear factor κ-light-chain-enhancer of activated B cells), a protein complex involved in the transcription of DNA. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ammonium pyrrolidinedithiocarbamate (CHEBI:234321) has role NF-κB inhibitor (CHEBI:73240) |
| ammonium pyrrolidinedithiocarbamate (CHEBI:234321) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| azanium;pyrrolidine-1-carbodithioate |
| Synonym | Source |
|---|---|
| ammonium pyrrolidine-1-carbodithioate | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| CAS:5108-96-3 | SUBMITTER |
| Citations |
|---|