EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11ClN2O |
| Net Charge | 0 |
| Average Mass | 198.653 |
| Monoisotopic Mass | 198.05599 |
| SMILES | Clc1ccc(OC[C@H]2CCN2)cn1 |
| InChI | InChI=1S/C9H11ClN2O/c10-9-2-1-8(5-12-9)13-6-7-3-4-11-7/h1-2,5,7,11H,3-4,6H2/t7-/m1/s1 |
| InChIKey | MKTAGSRKQIGEBH-SSDOTTSWSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. antinociceptive agent Any agent that inhibits nociception. nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. |
| Applications: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. antinociceptive agent Any agent that inhibits nociception. nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tebanicline (CHEBI:234304) has role antinociceptive agent (CHEBI:228138) |
| tebanicline (CHEBI:234304) has role nicotinic acetylcholine receptor agonist (CHEBI:47958) |
| tebanicline (CHEBI:234304) has role non-narcotic analgesic (CHEBI:35481) |
| tebanicline (CHEBI:234304) is a aromatic ether (CHEBI:35618) |
| tebanicline (CHEBI:234304) is a azetidines (CHEBI:38777) |
| tebanicline (CHEBI:234304) is a monochloropyridine (CHEBI:39172) |
| IUPAC Name |
|---|
| 5-[(2R)-azetidin-2-ylmethoxy]-2-chloropyridine |
| INNs | Source |
|---|---|
| tebaniclina | WHO MedNet |
| tebanicline | WHO MedNet |
| tébanicline | WHO MedNet |
| tebaniclinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 5-[(2R)-2-azetidinylmethoxy]-2-chloropyridine | ChEBI |
| 5-[((2R)-azetidin-2-yl)methoxy]-2-chloropyridine | ChEBI |
| 5-((2R)-azetidinylmethoxy)-2-chloropyridine | ChEBI |
| ABT 594 | ChEBI |
| ABT-594 | ChEBI |
| ABT594 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Tebanicline | Wikipedia |
| WO9953922 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:198283-73-7 | ChEBI |
| Citations |
|---|