EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H18O2 |
| Net Charge | 0 |
| Average Mass | 182.263 |
| Monoisotopic Mass | 182.13068 |
| SMILES | CC/C=C\CCC1(C)CCC(=O)O1 |
| InChI | InChI=1S/C11H18O2/c1-3-4-5-6-8-11(2)9-7-10(12)13-11/h4-5H,3,6-9H2,1-2H3/b5-4- |
| InChIKey | NIKDJTTZUYNCMM-PLNGDYQASA-N |
| Roles Classification |
|---|
| Chemical Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Biological Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxy-4-methyl-7-cis-decenoic acid γ-lactone (CHEBI:234289) has role flavouring agent (CHEBI:35617) |
| 4-hydroxy-4-methyl-7-cis-decenoic acid γ-lactone (CHEBI:234289) is a olefinic compound (CHEBI:78840) |
| 4-hydroxy-4-methyl-7-cis-decenoic acid γ-lactone (CHEBI:234289) is a tetrahydrofuranone (CHEBI:47016) |
| 4-hydroxy-4-methyl-7-cis-decenoic acid γ-lactone (CHEBI:234289) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| 5-[(3Z)-hex-3-en-1-yl]-5-methyldihydrofuran-2(3H)-one |
| Synonyms | Source |
|---|---|
| 4-methyl-cis-7-decene γ-lactone | ChEBI |
| 5-(3Z)-3-hexen-1-yldihydro-5-methyl-2(3H)-furanone | ChEBI |
| 5-[(3Z)-hex-3-en-1-yl]-5-methyloxolan-2-one | IUPAC |
| 5-(cis-3-hexenyl)dihydro-5-methyl-2(3H)furanone | ChEBI |
| 5-[(Z)-hex-3-enyl]-5-methyloxolan-2-one | ChEBI |
| FEMA 3937 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9479427 | Reaxys |
| CAS:70851-61-5 | ChEBI |
| Citations |
|---|