EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16O2 |
| Net Charge | 0 |
| Average Mass | 156.225 |
| Monoisotopic Mass | 156.11503 |
| SMILES | CC/C=C\CCCC(=O)OC |
| InChI | InChI=1S/C9H16O2/c1-3-4-5-6-7-8-9(10)11-2/h4-5H,3,6-8H2,1-2H3/b5-4- |
| InChIKey | TUHAYWWWVLJJJM-PLNGDYQASA-N |
| Roles Classification |
|---|
| Biological Roles: | flavouring agent A food additive that is used to added improve the taste or odour of a food. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl (Z)-5-octenoate (CHEBI:234283) has role flavouring agent (CHEBI:35617) |
| methyl (Z)-5-octenoate (CHEBI:234283) has role plant metabolite (CHEBI:76924) |
| methyl (Z)-5-octenoate (CHEBI:234283) is a methyl 5-octenoate (CHEBI:234286) |
| IUPAC Name |
|---|
| methyl (5Z)-oct-5-enoate |
| Synonyms | Source |
|---|---|
| methyl (Z)-oct-5-enoate | ChEBI |
| methyl (5Z)-5-octenoate | ChEBI |
| (5Z)-5-octenoic acid methyl ester | ChEBI |
| methyl cis-5-octenoate | ChEBI |
| methyl 5Z-octenoate | ChEBI |
| (Z)-5-octenoic acid methyl ester | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0303261 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:41654-15-3 | ChEBI |
| Citations |
|---|