EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:234245 - DADLE
| Formula | C29H39N5O7 |
| Net Charge | 0 |
| Average Mass | 569.659 |
| Monoisotopic Mass | 569.28495 |
| SMILES | CC(C)C[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)CNC(=O)[C@@H](C)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C29H39N5O7/c1-17(2)13-24(29(40)41)34-28(39)23(15-19-7-5-4-6-8-19)33-25(36)16-31-26(37)18(3)32-27(38)22(30)14-20-9-11-21(35)12-10-20/h4-12,17-18,22-24,35H,13-16,30H2,1-3H3,(H,31,37)(H,32,38)(H,33,36)(H,34,39)(H,40,41)/t18-,22+,23+,24-/m1/s1 |
| InChIKey | ZHUJMSMQIPIPTF-IBURTVSXSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | delta-opioid receptor agonist A compound that exhibits agonist activity at the δ-opioid receptor. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. antinociceptive agent Any agent that inhibits nociception. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. autophagy inducer Any compound that induces the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. delta-opioid receptor agonist A compound that exhibits agonist activity at the δ-opioid receptor. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. antinociceptive agent Any agent that inhibits nociception. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. cardioprotective agent Any protective agent that is able to prevent damage to the heart. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| DADLE (CHEBI:234245) has role antinociceptive agent (CHEBI:228138) |
| DADLE (CHEBI:234245) has role autophagy inducer (CHEBI:138880) |
| DADLE (CHEBI:234245) has role cardioprotective agent (CHEBI:77307) |
| DADLE (CHEBI:234245) has role geroprotector (CHEBI:176497) |
| DADLE (CHEBI:234245) has role neuroprotective agent (CHEBI:63726) |
| DADLE (CHEBI:234245) has role opioid analgesic (CHEBI:35482) |
| DADLE (CHEBI:234245) has role δ-opioid receptor agonist (CHEBI:64054) |
| DADLE (CHEBI:234245) has role μ-opioid receptor agonist (CHEBI:55322) |
| DADLE (CHEBI:234245) is a pentapeptide (CHEBI:48545) |
| IUPAC Name |
|---|
| L-tyrosyl-D-alanylglycyl-L-phenylalanyl-D-leucine |
| Synonyms | Source |
|---|---|
| D-Ala2,D-Leu5-enkephalin | ChEBI |
| [D-Ala2, D-Leu5]-enkephalin | ChEBI |
| H-Tyr-D-Ala-Gly-Phe-D-Leu-OH | ChEBI |
| H-Tyr-D-L-Ala-Gly-L-Phe-D-Leu-OH | ChEBI |
| Tyr-D-Ala-Gly-Phe-D-Leu-OH | ChEBI |
| enkephalin-(2-D-Ala, 5-D-Leu) | ChEBI |
| Citations |
|---|