EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H35N5O4 |
| Net Charge | 0 |
| Average Mass | 397.520 |
| Monoisotopic Mass | 397.26890 |
| SMILES | [H][C@@]1(/C(O)=N/[C@]([H])(C(=N)O)[C@]([H])(C)CC)CCCN1C(=O)[C@@]([H])(/N=C(\O)[C@]([H])(C)N)C(C)C |
| InChI | InChI=1S/C19H35N5O4/c1-6-11(4)15(16(21)25)23-18(27)13-8-7-9-24(13)19(28)14(10(2)3)22-17(26)12(5)20/h10-15H,6-9,20H2,1-5H3,(H2,21,25)(H,22,26)(H,23,27)/t11-,12+,13+,14+,15+/m1/s1 |
| InChIKey | JHPFUTHPFNABKY-QTVXIADOSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| H-Ala-Val-Pro-Ile-NH2 (CHEBI:234235) has role antineoplastic agent (CHEBI:35610) |
| H-Ala-Val-Pro-Ile-NH2 (CHEBI:234235) is a tetrapeptide (CHEBI:48030) |
| Synonyms | Source |
|---|---|
| Smac/DIABLO N-terminal tetrapeptide | SUBMITTER |
| Smac mimic | SUBMITTER |
| Citations |
|---|