EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H37N5O5 |
| Net Charge | 0 |
| Average Mass | 499.612 |
| Monoisotopic Mass | 499.27947 |
| SMILES | [H]C(C/C(O)=N/O)(CC(C)C)/C(O)=N/[C@@]([H])(Cc1ccc2ccccc2c1)/C(O)=N/[C@@]([H])(C)/C(O)=N/CCN |
| InChI | InChI=1S/C26H37N5O5/c1-16(2)12-21(15-23(32)31-36)25(34)30-22(26(35)29-17(3)24(33)28-11-10-27)14-18-8-9-19-6-4-5-7-20(19)13-18/h4-9,13,16-17,21-22,36H,10-12,14-15,27H2,1-3H3,(H,28,33)(H,29,35)(H,30,34)(H,31,32)/t17-,21?,22-/m0/s1 |
| InChIKey | AWNBSWDIOCXWJW-OWHMDLSXSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.4.24.* (metalloendopeptidase) inhibitor Any EC 3.4.* (hydrolases acting on peptide bond) inhibitor that interferes with the activity of a metalloendopeptidase (EC 3.4.24.*). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| TAPI-1 (CHEBI:234202) has role EC 3.4.24.* (metalloendopeptidase) inhibitor (CHEBI:59107) |
| TAPI-1 (CHEBI:234202) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| N-[(2S)-1-[[(2S)-1-(2-aminoethylamino)-1-oxopropan-2-yl]amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]-N'-hydroxy-2-(2-methylpropyl)butanediamide |
| Synonym | Source |
|---|---|
| TNF-α processing inhibitor-1 | SUBMITTER |
| Citations |
|---|