EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H11Cl2I2NO3 |
| Net Charge | 0 |
| Average Mass | 626.015 |
| Monoisotopic Mass | 624.82054 |
| SMILES | O=C(Nc1ccc(Oc2ccc(Cl)cc2)c(Cl)c1)c1cc(I)cc(I)c1O |
| InChI | InChI=1S/C19H11Cl2I2NO3/c20-10-1-4-13(5-2-10)27-17-6-3-12(9-15(17)21)24-19(26)14-7-11(22)8-16(23)18(14)25/h1-9,25H,(H,24,26) |
| InChIKey | NEMNPWINWMHUMR-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. B-Raf inhibitor A serine/threonine kinase inhibitor that specifically inhibits human mutant serine/threonine kinase (B-Raf) chemosensitiser Any compound that can sensitise tumour cells to chemotherapy. autophagy inducer Any compound that induces the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). EC 2.7.11.22 (cyclin-dependent kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of cyclin-dependent kinase (EC 2.7.11.22). DNA synthesis inhibitor Any substance that inhibits the synthesis of DNA. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | anthelminthic drug Substance intended to kill parasitic worms (helminths). antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rafoxanide (CHEBI:234200) has role anthelminthic drug (CHEBI:35443) |
| rafoxanide (CHEBI:234200) has role antibacterial agent (CHEBI:33282) |
| rafoxanide (CHEBI:234200) has role antifungal agent (CHEBI:35718) |
| rafoxanide (CHEBI:234200) has role antineoplastic agent (CHEBI:35610) |
| rafoxanide (CHEBI:234200) has role autophagy inducer (CHEBI:138880) |
| rafoxanide (CHEBI:234200) has role B-Raf inhibitor (CHEBI:75047) |
| rafoxanide (CHEBI:234200) has role chemosensitiser (CHEBI:233442) |
| rafoxanide (CHEBI:234200) has role DNA synthesis inhibitor (CHEBI:59517) |
| rafoxanide (CHEBI:234200) has role EC 2.7.11.22 (cyclin-dependent kinase) inhibitor (CHEBI:82665) |
| rafoxanide (CHEBI:234200) is a aromatic ether (CHEBI:35618) |
| rafoxanide (CHEBI:234200) is a benzamides (CHEBI:22702) |
| rafoxanide (CHEBI:234200) is a monochlorobenzenes (CHEBI:83403) |
| rafoxanide (CHEBI:234200) is a organoiodine compound (CHEBI:37142) |
| rafoxanide (CHEBI:234200) is a phenols (CHEBI:33853) |
| rafoxanide (CHEBI:234200) is a salicylanilides (CHEBI:53468) |
| rafoxanide (CHEBI:234200) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| N-[3-chloro-4-(4-chlorophenoxy)phenyl]-2-hydroxy-3,5-diiodobenzamide |
| INNs | Source |
|---|---|
| rafoxanida | WHO MedNet |
| rafoxanide | WHO MedNet |
| rafoxanide | WHO MedNet |
| rafoxanidum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 3,5-diiodo-3'-chloro-4'-(p-chlorophenoxy)salicylanilide | ChEBI |
| 3,5-diodo-3'-chloro-4'-(p-chlorophenoxy)salicylanilide | ChEBI |
| 3'-chloro-4'-(4-chlorophenoxy)-3,5-diiodosalicylanilide | ChEBI |
| 3'-chloro-4'-(p-chlorophenoxy)-3,5-diiodosalicylanilide | ChEBI |
| NSC 355278 | ChEBI |
| NSC-355278 | ChEBI |
| Brand Names | Source |
|---|---|
| Disalan | ChEBI |
| Ranide | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D05693 | KEGG DRUG |
| OX9 | PDBeChem |
| Rafoxanide | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:22662-39-1 | ChEBI |
| Citations |
|---|