EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H11Cl2I2NO3 |
| Net Charge | 0 |
| Average Mass | 626.015 |
| Monoisotopic Mass | 624.82054 |
| SMILES | O=C(Nc1ccc(Oc2ccc(Cl)cc2)c(Cl)c1)c1cc(I)cc(I)c1O |
| InChI | InChI=1S/C19H11Cl2I2NO3/c20-10-1-4-13(5-2-10)27-17-6-3-12(9-15(17)21)24-19(26)14-7-11(22)8-16(23)18(14)25/h1-9,25H,(H,24,26) |
| InChIKey | NEMNPWINWMHUMR-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. chemosensitiser Any compound that can sensitise tumour cells to chemotherapy. B-Raf inhibitor A serine/threonine kinase inhibitor that specifically inhibits human mutant serine/threonine kinase (B-Raf) DNA synthesis inhibitor Any substance that inhibits the synthesis of DNA. autophagy inducer Any compound that induces the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. EC 2.7.11.22 (cyclin-dependent kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of cyclin-dependent kinase (EC 2.7.11.22). |
| Applications: | anthelminthic drug Substance intended to kill parasitic worms (helminths). antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rafoxanide (CHEBI:234200) has role anthelminthic drug (CHEBI:35443) |
| rafoxanide (CHEBI:234200) has role antibacterial agent (CHEBI:33282) |
| rafoxanide (CHEBI:234200) has role antifungal agent (CHEBI:35718) |
| rafoxanide (CHEBI:234200) has role antineoplastic agent (CHEBI:35610) |
| rafoxanide (CHEBI:234200) has role autophagy inducer (CHEBI:138880) |
| rafoxanide (CHEBI:234200) has role B-Raf inhibitor (CHEBI:75047) |
| rafoxanide (CHEBI:234200) has role chemosensitiser (CHEBI:233442) |
| rafoxanide (CHEBI:234200) has role DNA synthesis inhibitor (CHEBI:59517) |
| rafoxanide (CHEBI:234200) has role EC 2.7.11.22 (cyclin-dependent kinase) inhibitor (CHEBI:82665) |
| rafoxanide (CHEBI:234200) is a aromatic ether (CHEBI:35618) |
| rafoxanide (CHEBI:234200) is a benzamides (CHEBI:22702) |
| rafoxanide (CHEBI:234200) is a monochlorobenzenes (CHEBI:83403) |
| rafoxanide (CHEBI:234200) is a organoiodine compound (CHEBI:37142) |
| rafoxanide (CHEBI:234200) is a phenols (CHEBI:33853) |
| rafoxanide (CHEBI:234200) is a salicylanilides (CHEBI:53468) |
| rafoxanide (CHEBI:234200) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| N-[3-chloro-4-(4-chlorophenoxy)phenyl]-2-hydroxy-3,5-diiodobenzamide |
| INNs | Source |
|---|---|
| rafoxanida | WHO MedNet |
| rafoxanide | WHO MedNet |
| rafoxanide | WHO MedNet |
| rafoxanidum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 3,5-diiodo-3'-chloro-4'-(p-chlorophenoxy)salicylanilide | ChEBI |
| 3,5-diodo-3'-chloro-4'-(p-chlorophenoxy)salicylanilide | ChEBI |
| 3'-chloro-4'-(4-chlorophenoxy)-3,5-diiodosalicylanilide | ChEBI |
| 3'-chloro-4'-(p-chlorophenoxy)-3,5-diiodosalicylanilide | ChEBI |
| NSC 355278 | ChEBI |
| NSC-355278 | ChEBI |
| Brand Names | Source |
|---|---|
| Disalan | ChEBI |
| Ranide | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D05693 | KEGG DRUG |
| OX9 | PDBeChem |
| Rafoxanide | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:22662-39-1 | ChEBI |
| Citations |
|---|