EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H10Te2 |
| Net Charge | 0 |
| Average Mass | 409.412 |
| Monoisotopic Mass | 413.89070 |
| SMILES | c1ccc([Te][Te]c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10Te2/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12/h1-10H |
| InChIKey | VRLFOXMNTSYGMX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | neurotoxin A poison that interferes with the functions of the nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diphenyl ditelluride (CHEBI:234137) has role neurotoxin (CHEBI:50910) |
| diphenyl ditelluride (CHEBI:234137) is a inorganic molecular entity (CHEBI:24835) |
| IUPAC Name |
|---|
| (phenylditellanyl)benzene |
| Synonym | Source |
|---|---|
| diphenylditelluride | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| Diphenyl_ditelluride | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:32294-60-3 | SUBMITTER |
| Citations |
|---|