EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H28Cl2NO3P.HCl |
| Net Charge | 0 |
| Average Mass | 444.767 |
| Monoisotopic Mass | 443.09506 |
| SMILES | Cl.[H][C@](O)(CN[C@@]([H])(C)c1ccc(Cl)c(Cl)c1)CP(=O)(O)CC1CCCCC1 |
| InChI | InChI=1S/C18H28Cl2NO3P.ClH/c1-13(15-7-8-17(19)18(20)9-15)21-10-16(22)12-25(23,24)11-14-5-3-2-4-6-14;/h7-9,13-14,16,21-22H,2-6,10-12H2,1H3,(H,23,24);1H/t13-,16-;/m0./s1 |
| InChIKey | ZQCFHOVIXCJPLE-LINSIKMZSA-N |
| Roles Classification |
|---|
| Biological Role: | GABA antagonist A compound that inhibits the action of γ-aminobutyric acid. |
| Application: | GABA antagonist A compound that inhibits the action of γ-aminobutyric acid. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CGP 54626 hydrochloride (CHEBI:234136) has role GABA antagonist (CHEBI:65259) |
| CGP 54626 hydrochloride (CHEBI:234136) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| CGP-54626 | SUBMITTER |
| cyclohexylmethyl-[(2S)-3-[[(1S)-1-(3,4-dichlorophenyl)ethyl]amino]-2-hydroxypropyl]phosphinic acid;hydrochloride | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| CAS:149184-21-4 | SUBMITTER |
| Citations |
|---|