EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H12N2O.HCl |
| Net Charge | 0 |
| Average Mass | 236.702 |
| Monoisotopic Mass | 236.07164 |
| SMILES | CC1=NCCc2c1nc1cc(O)ccc21.Cl |
| InChI | InChI=1S/C12H12N2O.ClH/c1-7-12-10(4-5-13-7)9-3-2-8(15)6-11(9)14-12;/h2-3,6,14-15H,4-5H2,1H3;1H |
| InChIKey | BSWAWVOHMZNXOS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| harmalol hydrochloride (CHEBI:234132) has role antioxidant (CHEBI:22586) |
| harmalol hydrochloride (CHEBI:234132) is a alkaloid (CHEBI:22315) |
| IUPAC Name |
|---|
| 1-methyl-4,9-dihydro-3H-pyrido[3,4-b]indol-7-ol;hydrochloride |
| Registry Numbers | Sources |
|---|---|
| CAS:6028-07-5 | SUBMITTER |
| Citations |
|---|