EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H24INO2 |
| Net Charge | 0 |
| Average Mass | 413.299 |
| Monoisotopic Mass | 413.08518 |
| SMILES | [H]C12CC[C@@]([H])(N1C)[C@@]([H])(C(=O)OC(C)C)[C@@]([H])(c1ccc(I)cc1)C2 |
| InChI | InChI=1S/C18H24INO2/c1-11(2)22-18(21)17-15(12-4-6-13(19)7-5-12)10-14-8-9-16(17)20(14)3/h4-7,11,14-17H,8-10H2,1-3H3/t14?,15-,16-,17+/m1/s1 |
| InChIKey | ZAQLTGAFVMGUMB-IFFAKLHKSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | dopamine uptake inhibitor A dopaminergic agent that blocks the transport of dopamine into axon terminals or into storage vesicles within terminals. Most of the adrenergic uptake inhibitors also inhibit dopamine uptake. |
| Application: | dopamine uptake inhibitor A dopaminergic agent that blocks the transport of dopamine into axon terminals or into storage vesicles within terminals. Most of the adrenergic uptake inhibitors also inhibit dopamine uptake. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| RTI-121 (CHEBI:234124) has role dopamine uptake inhibitor (CHEBI:51039) |
| RTI-121 (CHEBI:234124) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| propan-2-yl (1R,2S,3S)-3-(4-iodophenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate |
| Synonym | Source |
|---|---|
| RTI 121 | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| RTI-121 | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:146145-21-3 | SUBMITTER |
| Citations |
|---|