EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H8NO5.Na |
| Net Charge | 0 |
| Average Mass | 281.199 |
| Monoisotopic Mass | 281.03002 |
| SMILES | [H]C(=Cc1ccc([N+](=O)[O-])o1)c1ccc(C(=O)[O-])cc1.[Na+] |
| InChI | InChI=1S/C13H9NO5.Na/c15-13(16)10-4-1-9(2-5-10)3-6-11-7-8-12(19-11)14(17)18;/h1-8H,(H,15,16);/q;+1/p-1 |
| InChIKey | FGNXRHWAZABZSZ-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium nifurstyrenate (CHEBI:234123) has part nifurstyrenate (CHEBI:234122) |
| sodium nifurstyrenate (CHEBI:234123) has role antibacterial agent (CHEBI:33282) |
| sodium nifurstyrenate (CHEBI:234123) has role antiinfective agent (CHEBI:35441) |
| sodium nifurstyrenate (CHEBI:234123) is a organic sodium salt (CHEBI:38700) |
| Incoming Relation(s) |
| sodium (E)-nifurstyrenate (CHEBI:234143) is a sodium nifurstyrenate (CHEBI:234123) |
| sodium (Z)-nifurstyrenate (CHEBI:234142) is a sodium nifurstyrenate (CHEBI:234123) |
| IUPAC Name |
|---|
| sodium 4-[2-(5-nitrofuran-2-yl)ethenyl]benzoate |
| Synonyms | Source |
|---|---|
| NSA-Na | ChEBI |
| β-(5-nitro-2-furyl)-p-carboxystyrene sodium salt | ChEBI |
| nifurstyrenic acid sodium salt | ChEBI |
| nifurstyrenic acid, sodium salt | ChEBI |
| 4-[2-(5-nitro-2-furyl)vinyl]benzoic acid sodium salt | ChEBI |
| Citations |
|---|