EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H27NO2.HCl |
| Net Charge | 0 |
| Average Mass | 373.924 |
| Monoisotopic Mass | 373.18086 |
| SMILES | Cl.[H][C@@]1(C[C@]([H])(O)c2ccccc2)CCC[C@]([H])(CC(=O)c2ccccc2)N1C |
| InChI | InChI=1S/C22H27NO2.ClH/c1-23-19(15-21(24)17-9-4-2-5-10-17)13-8-14-20(23)16-22(25)18-11-6-3-7-12-18;/h2-7,9-12,19-21,24H,8,13-16H2,1H3;1H/t19-,20+,21-;/m0./s1 |
| InChIKey | MKMYPTLXLWOUSO-NFQNBQCWSA-N |
| Roles Classification |
|---|
| Biological Role: | cholinergic drug Any drug used for its actions on cholinergic systems. Included here are agonists and antagonists, drugs that affect the life cycle of acetylcholine, and drugs that affect the survival of cholinergic neurons. |
| Application: | cholinergic drug Any drug used for its actions on cholinergic systems. Included here are agonists and antagonists, drugs that affect the life cycle of acetylcholine, and drugs that affect the survival of cholinergic neurons. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lobeline hydrochloride (CHEBI:234117) has role cholinergic drug (CHEBI:38323) |
| lobeline hydrochloride (CHEBI:234117) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 2-[(2R,6S)-6-[(2S)-2-hydroxy-2-phenylethyl]-1-methylpiperidin-2-yl]-1-phenylethanone;hydrochloride |
| Manual Xrefs | Databases |
|---|---|
| D02202 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:63990-84-1 | SUBMITTER |
| Citations |
|---|