EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H12ClF3N2O4 |
| Net Charge | 0 |
| Average Mass | 460.795 |
| Monoisotopic Mass | 460.04377 |
| SMILES | [H]/C(=C1/C(=O)N(c2ccc(Cl)c(C(=O)O)c2)N=C1C(F)(F)F)c1ccc(-c2ccccc2)o1 |
| InChI | InChI=1S/C22H12ClF3N2O4/c23-17-8-6-13(10-15(17)21(30)31)28-20(29)16(19(27-28)22(24,25)26)11-14-7-9-18(32-14)12-4-2-1-3-5-12/h1-11H,(H,30,31)/b16-11- |
| InChIKey | RSLFQCNAOMQAIH-WJDWOHSUSA-N |
| Roles Classification |
|---|
| Biological Role: | inhibitor A substance that diminishes the rate of a chemical reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| EN460 (CHEBI:234114) has role inhibitor (CHEBI:35222) |
| EN460 (CHEBI:234114) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 2-chloro-5-[(4Z)-5-oxo-4-[(5-phenylfuran-2-yl)methylidene]-3-(trifluoromethyl)pyrazol-1-yl]benzoic acid |
| Synonym | Source |
|---|---|
| ERO1 Inhibitor II | SUBMITTER |
| Citations |
|---|