EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H34N8O5 |
| Net Charge | 0 |
| Average Mass | 586.653 |
| Monoisotopic Mass | 586.26522 |
| SMILES | COC(=O)N1CCC(n2ncc3c(N4CCOCC4)nc(-c4ccc(NC(=O)Nc5ccc(CO)cc5)cc4)nc32)CC1 |
| InChI | InChI=1S/C30H34N8O5/c1-42-30(41)37-12-10-24(11-13-37)38-28-25(18-31-38)27(36-14-16-43-17-15-36)34-26(35-28)21-4-8-23(9-5-21)33-29(40)32-22-6-2-20(19-39)3-7-22/h2-9,18,24,39H,10-17,19H2,1H3,(H2,32,33,40) |
| InChIKey | DLIGFKRUAOAIBA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor An inhibitor of phosphatidylinositol 3-kinase, EC 2.7.1.137, a family of related enzymes capable of phosphorylating the 3 position hydroxy group of the inositol ring of a phosphatidylinositol. mTOR inhibitor A protein kinase inhibitor of the mammalian target of rapamycin (mTOR), a protein that regulates cell growth, cell proliferation, cell motility, cell survival, protein synthesis and transcription. mTOR inhibitors are used to prevent transplant rejection and in treatment of cancer. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| WYE-28 (CHEBI:234113) has role antineoplastic agent (CHEBI:35610) |
| WYE-28 (CHEBI:234113) has role EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor (CHEBI:50914) |
| WYE-28 (CHEBI:234113) has role mTOR inhibitor (CHEBI:68481) |
| WYE-28 (CHEBI:234113) is a aromatic primary alcohol (CHEBI:33857) |
| WYE-28 (CHEBI:234113) is a benzyl alcohols (CHEBI:22743) |
| WYE-28 (CHEBI:234113) is a carbamate ester (CHEBI:23003) |
| WYE-28 (CHEBI:234113) is a morpholines (CHEBI:38785) |
| WYE-28 (CHEBI:234113) is a phenylureas (CHEBI:134043) |
| WYE-28 (CHEBI:234113) is a piperidinecarboxylate ester (CHEBI:48630) |
| WYE-28 (CHEBI:234113) is a pyrazolopyrimidine (CHEBI:38669) |
| IUPAC Name |
|---|
| methyl 4-{6-[4-({[4-(hydroxymethyl)phenyl]carbamoyl}amino)phenyl]-4-(morpholin-4-yl)-1H-pyrazolo[3,4-d]pyrimidin-1-yl}piperidine-1-carboxylate |
| Synonyms | Source |
|---|---|
| methyl 4-[6-[4-[[4-(hydroxymethyl)phenyl]carbamoylamino]phenyl]-4-morpholin-4-ylpyrazolo[3,4-d]pyrimidin-1-yl]piperidine-1-carboxylate | SUBMITTER |
| mTOR inhibitor WYE-28 | SUBMITTER |
| WYE 28 | ChEBI |
| WYE28 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:1062172-60-4 | ChEBI |
| Citations |
|---|