EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14O7 |
| Net Charge | 0 |
| Average Mass | 318.281 |
| Monoisotopic Mass | 318.07395 |
| SMILES | C[C@@]1(O)Cc2cc3cc(O)cc(O)c3c(O)c2C(=O)C1C(=O)O |
| InChI | InChI=1S/C16H14O7/c1-16(23)5-7-2-6-3-8(17)4-9(18)10(6)13(19)11(7)14(20)12(16)15(21)22/h2-4,12,17-19,23H,5H2,1H3,(H,21,22)/t12?,16-/m1/s1 |
| InChIKey | VKCGEUGXAZNCKN-PVQCJRHBSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3R)-atrochrysone carboxylic acid (CHEBI:234109) is a atrochrysone carboxylic acid (CHEBI:234108) |
| (3R)-atrochrysone carboxylic acid (CHEBI:234109) is conjugate acid of (3R)-atrochrysone carboxylate (CHEBI:234107) |
| Incoming Relation(s) |
| (3R)-atrochrysone carboxylate (CHEBI:234107) is conjugate base of (3R)-atrochrysone carboxylic acid (CHEBI:234109) |
| IUPAC Name |
|---|
| (3R)-3,6,8,9-tetrahydroxy-3-methyl-1-oxo-1,2,3,4-tetrahydroanthracene-2-carboxylic acid |
| Citations |
|---|