EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H31N4O6.Mg.3Na |
| Net Charge | 0 |
| Average Mass | 684.919 |
| Monoisotopic Mass | 684.17871 |
| SMILES | [H][C@@]1(CCC(=O)[O-])Cc2nc1c(C)c1nc(cc3[n-]c(cc4[n-]c(c(C(=O)[O-])c4C)c2CC(=O)[O-])c(CC)c3C)C(C=C)=C1C.[Mg+2].[Na+].[Na+].[Na+] |
| InChI | InChI=1S/C34H36N4O6.Mg.3Na/c1-7-20-15(3)23-13-27-21(8-2)16(4)31(37-27)18(6)32-19(9-10-28(39)40)11-25(38-32)22(12-29(41)42)33-30(34(43)44)17(5)24(36-33)14-26(20)35-23;;;;/h8,13-14,19H,2,7,9-12H2,1,3-6H3,(H5,35,36,37,38,39,40,41,42,43,44);;;;/q;+2;3*+1/p-5/t19-;;;;/m1..../s1 |
| InChIKey | JVOGSHDZLOJKKR-MXFMKSRJSA-I |
| Roles Classification |
|---|
| Application: | photosensitizing agent A chemical compound that can be excited by light of a specific wavelength and subsequently transfer energy to a chosen reactant. This is commonly molecular oxygen within a cancer tissue, which is converted to (highly rective) singlet state oxygen. This rapidly reacts with any nearby biomolecules, ultimately killing the cancer cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium magnesium chlorophyllin (CHEBI:234098) has role photosensitizing agent (CHEBI:47868) |
| sodium magnesium chlorophyllin (CHEBI:234098) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| magnesium;trisodium;(17R)-17-(2-carboxylatoethyl)-20-(carboxylatomethyl)-12-ethenyl-7-ethyl-3,8,13,15-tetramethyl-17,18-dihydroporphyrin-21,23-diide-2-carboxylate |
| Registry Numbers | Sources |
|---|---|
| CAS:15203-43-7 | SUBMITTER |
| Citations |
|---|