EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22Cl2N6O |
| Net Charge | 0 |
| Average Mass | 397.310 |
| Monoisotopic Mass | 396.12321 |
| SMILES | Cc1cc(NCCCN(C)C)nc(NC(=O)Nc2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C17H22Cl2N6O/c1-11-9-15(20-7-4-8-25(2)3)23-16(21-11)24-17(26)22-12-5-6-13(18)14(19)10-12/h5-6,9-10H,4,7-8H2,1-3H3,(H3,20,21,22,23,24,26) |
| InChIKey | MWEZWAONAIZIAQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | OLIG2 inhibitor Any inhibitor of OLIG2. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CT-179 (CHEBI:234076) has role antineoplastic agent (CHEBI:35610) |
| CT-179 (CHEBI:234076) has role OLIG2 inhibitor (CHEBI:234089) |
| CT-179 (CHEBI:234076) is a dichlorobenzene (CHEBI:23697) |
| CT-179 (CHEBI:234076) is a phenylureas (CHEBI:134043) |
| CT-179 (CHEBI:234076) is a pyridines (CHEBI:26421) |
| CT-179 (CHEBI:234076) is a secondary amino compound (CHEBI:50995) |
| CT-179 (CHEBI:234076) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 1-(3,4-dichlorophenyl)-3-(4-{[3-(dimethylamino)propyl]amino}-6-methylpyrimidin-2-yl)urea |
| Synonyms | Source |
|---|---|
| 1-(2-(3-(3,4-dichlorophenyl)ureido)-6-methyl-pyrimidin-4-yl)-amino-3(dimethylamino)propane | SUBMITTER |
| CT 179 | DrugBank |
| CT179 | DrugBank |
| N-(3,4-dichlorophenyl)-N'-(4-{[3-(dimethylamino)propyl]amino}-6-methylpyrimidin-2-yl)urea | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| DB17114 | DrugBank |
| WO2016138479 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:1996636-69-1 | SUBMITTER |
| Citations |
|---|