EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16N2 |
| Net Charge | 0 |
| Average Mass | 164.252 |
| Monoisotopic Mass | 164.13135 |
| SMILES | CCCCc1ncc(C)nc1C |
| InChI | InChI=1S/C10H16N2/c1-4-5-6-10-9(3)12-8(2)7-11-10/h7H,4-6H2,1-3H3 |
| InChIKey | CSGGOEBNSRAFPU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lactiplantibacillus plantarum (ncbitaxon:1590) | - | PubMed (31673827) | Species also known as Lactobacillus plantarum. |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-butyl-3,5-dimethylpyrazine (CHEBI:234045) has role bacterial metabolite (CHEBI:76969) |
| 2-butyl-3,5-dimethylpyrazine (CHEBI:234045) has role pheromone (CHEBI:26013) |
| 2-butyl-3,5-dimethylpyrazine (CHEBI:234045) has role plant metabolite (CHEBI:76924) |
| 2-butyl-3,5-dimethylpyrazine (CHEBI:234045) is a pyrazines (CHEBI:38314) |
| IUPAC Name |
|---|
| 2-butyl-3,5-dimethylpyrazine |
| Synonyms | Source |
|---|---|
| 2,6-dimethyl-3-butylpyrazine | ChEBI |
| 3,5-dimethyl-2-butylpyrazine | NIST Chemistry WebBook |
| 3-butyl-2,6-dimethylpyrazine | NIST Chemistry WebBook |
| Registry Numbers | Sources |
|---|---|
| CAS:50888-63-6 | NIST Chemistry WebBook |
| Citations |
|---|