EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:234041 - 5-hydroxydecanoate
| Formula | C10H19O3 |
| Net Charge | -1 |
| Average Mass | 187.259 |
| Monoisotopic Mass | 187.13397 |
| SMILES | CCCCCC(O)CCCC(=O)[O-] |
| InChI | InChI=1S/C10H20O3/c1-2-3-4-6-9(11)7-5-8-10(12)13/h9,11H,2-8H2,1H3,(H,12,13)/p-1 |
| InChIKey | LMHJFKYQYDSOQO-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | potassium channel blocker An agent that inhibits cell membrane glycoproteins that are selectively permeable to potassium ions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-hydroxydecanoate (CHEBI:234041) has role potassium channel blocker (CHEBI:50509) |
| 5-hydroxydecanoate (CHEBI:234041) is a organic molecular entity (CHEBI:50860) |
| 5-hydroxydecanoate (CHEBI:234041) is conjugate base of 5-Hydroxycapric acid (CHEBI:165412) |
| Incoming Relation(s) |
| 5-Hydroxycapric acid (CHEBI:165412) is conjugate acid of 5-hydroxydecanoate (CHEBI:234041) |
| IUPAC Name |
|---|
| 5-hydroxydecanoate |
| Citations |
|---|