EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10O6 |
| Net Charge | 0 |
| Average Mass | 286.239 |
| Monoisotopic Mass | 286.04774 |
| SMILES | O=c1c(-c2ccc(O)cc2)coc2c(O)c(O)cc(O)c12 |
| InChI | InChI=1S/C15H10O6/c16-8-3-1-7(2-4-8)9-6-21-15-12(13(9)19)10(17)5-11(18)14(15)20/h1-6,16-18,20H |
| InChIKey | ZKZCRGBCWBCSNJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus phoenicis (ncbitaxon:5063) | - | PubMed (24705463) | |
| Iris kashmiriana (IPNI:438752-1) | - | PubMed (28108024) |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-hydroxygenistein (CHEBI:234032) has role plant metabolite (CHEBI:76924) |
| 8-hydroxygenistein (CHEBI:234032) has role radical scavenger (CHEBI:48578) |
| 8-hydroxygenistein (CHEBI:234032) is a 4'-hydroxyisoflavones (CHEBI:63328) |
| 8-hydroxygenistein (CHEBI:234032) is a 7-hydroxyisoflavones (CHEBI:55465) |
| IUPAC Name |
|---|
| 5,7,8-trihydroxy-3-(4-hydroxyphenyl)-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 5,7,8-trihydroxy-3-(4-hydroxyphenyl)chromen-4-one | SUBMITTER |
| 5,7,8-trihydroxy-3-(4-hydroxyphenyl)-4H-1-benzopyran-4-one | IUPAC |
| 4',5,7,8-tetrahydroxyisoflavone | ChEBI |
| 8-OHG | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0303375 | HMDB |
| FDB012252 | FooDB |
| C00018071 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| CAS:13539-27-0 | SUBMITTER |
| Citations |
|---|