EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:234030 - strychnine nitrate
| Formula | C21H22N2O2.HNO3 |
| Net Charge | 0 |
| Average Mass | 397.431 |
| Monoisotopic Mass | 397.16377 |
| SMILES | O=[N+]([O-])O.[H][C@@]12N3C(=O)C[C@]4([H])OCC=C5CN6CC[C@@]1(c1ccccc13)[C@]6([H])C[C@]5([H])[C@]24[H] |
| InChI | InChI=1S/C21H22N2O2.HNO3/c24-18-10-16-19-13-9-17-21(6-7-22(17)11-12(13)5-8-25-16)14-3-1-2-4-15(14)23(18)20(19)21;2-1(3)4/h1-5,13,16-17,19-20H,6-11H2;(H,2,3,4)/t13-,16-,17-,19-,20-,21+;/m0./s1 |
| InChIKey | PCGVPMHGSJFFTI-ZEYGOCRCSA-N |
| Roles Classification |
|---|
| Biological Role: | poison Any substance that causes disturbance to organisms by chemical reaction or other activity on the molecular scale, when a sufficient quantity is absorbed by the organism. |
| Application: | convulsant A drug that induces seizures or increases their severity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| strychnine nitrate (CHEBI:234030) has role convulsant (CHEBI:231761) |
| strychnine nitrate (CHEBI:234030) has role poison (CHEBI:64909) |
| strychnine nitrate (CHEBI:234030) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| (4aR,5aS,8aR,13aS,15aS,15bR)-4a,5,5a,7,8,13a,15,15a,15b,16-decahydro-2H-4,6-methanoindolo[3,2,1-ij]oxepino[2,3,4-de]pyrrolo[2,3-h]quinolin-14-one;nitric acid |
| Registry Numbers | Sources |
|---|---|
| CAS:66-32-0 | SUBMITTER |
| Citations |
|---|