EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H8O4 |
| Net Charge | 0 |
| Average Mass | 204.181 |
| Monoisotopic Mass | 204.04226 |
| SMILES | Cc1cc(=O)oc2c(C=O)c(O)ccc12 |
| InChI | InChI=1S/C11H8O4/c1-6-4-10(14)15-11-7(6)2-3-9(13)8(11)5-12/h2-5,13H,1H3 |
| InChIKey | RTHHSXOVIJWFQP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 2.7.11.* (protein-serine/threonine kinase) inhibitor An EC 2.7.* (P-containing group transferase) inhibitor that interferes with the action of any protein-serine/threonine kinase (EC 2.7.11.*). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4μ8C (CHEBI:233999) has role EC 2.7.11.* (protein-serine/threonine kinase) inhibitor (CHEBI:76812) |
| 4μ8C (CHEBI:233999) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 7-hydroxy-4-methyl-2-oxochromene-8-carbaldehyde |
| Synonyms | Source |
|---|---|
| 7-hydroxy-4-methyl-2-oxo-2H-chromene-8-carbaldehyde | SUBMITTER |
| IRE1 Inhibitor III | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| CAS:14003-96-4 | SUBMITTER |
| Citations |
|---|