EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H12N6OS |
| Net Charge | 0 |
| Average Mass | 360.402 |
| Monoisotopic Mass | 360.07933 |
| SMILES | c1ccc(Cn2nnc3c(Sc4nc5ccccc5o4)ncnc32)cc1 |
| InChI | InChI=1S/C18H12N6OS/c1-2-6-12(7-3-1)10-24-16-15(22-23-24)17(20-11-19-16)26-18-21-13-8-4-5-9-14(13)25-18/h1-9,11H,10H2 |
| InChIKey | HZSOKHVVANONPV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 1.6.3.1. [NAD(P)H oxidase (H2O2-forming)] inhibitor An EC 1.6.3.* (oxidoreductase acting on NADH or NADPH with oxygen as acceptor) inhibitor that interferes with the action of NAD(P)H oxidase (H2O2-forming), EC 1.6.3.1. |
| Applications: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| VAS2870 (CHEBI:233997) has role EC 1.6.3.1. [NAD(P)H oxidase (H2O2-forming)] inhibitor (CHEBI:50423) |
| VAS2870 (CHEBI:233997) has role neuroprotective agent (CHEBI:63726) |
| VAS2870 (CHEBI:233997) has role platelet aggregation inhibitor (CHEBI:50427) |
| VAS2870 (CHEBI:233997) is a 1,3-benzoxazoles (CHEBI:51548) |
| VAS2870 (CHEBI:233997) is a aryl sulfide (CHEBI:35683) |
| VAS2870 (CHEBI:233997) is a benzenes (CHEBI:22712) |
| VAS2870 (CHEBI:233997) is a triazolopyrimidines (CHEBI:48435) |
| IUPAC Name |
|---|
| 7-(1,3-benzoxazol-2-ylsulfanyl)-3-benzyl-3H-[1,2,3]triazolo[4,5-d]pyrimidine |
| Synonyms | Source |
|---|---|
| 2-(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)sulfanyl-1,3-benzoxazole | IUPAC |
| 3-benzyl-7-(2-benzoxazolyl)thio-1,2,3-triazolo[4,5-d]pyrimidine | ChEBI |
| 7-[(1,3-benzoxazol-2-yl)sulfanyl]-3-benzyl-3H-[1,2,3]triazolo[4,5-d]pyrimidine | IUPAC |
| PubChem 1,3-benzoxazol-2-yl 3-benzyl-3H-[1,2,3]triazolo[4,5-d]pyrimidin-7-yl sulfide | SUBMITTER |
| VAS 2870 | ChEBI |
| VAS-2870 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:722456-31-7 | SUBMITTER |
| Citations |
|---|